C22H31N5 — CID 174307442
1-[[4-amino-3-(methyliminomethyl)buta-1,3-dien-2-yl]amino]-N'-methyl-N-pent-1-en-3-ylidene-2,3,4,5-tetrahydro-1H-indene-5-carboximidamide (PubChem CID 174307442) has the molecular formula C22H31N5 and a molecular weight of 365.53 g/mol. Its IUPAC name is 1-[[4-amino-3-(methyliminomethyl)buta-1,3-dien-2-yl]amino]-N'-methyl-N-pent-1-en-3-ylidene-2,3,4,5-tetrahydro-1H-indene-5-carboximidamide.
| Compound Name | 1-[[4-amino-3-(methyliminomethyl)buta-1,3-dien-2-yl]amino]-N'-methyl-N-pent-1-en-3-ylidene-2,3,4,5-tetrahydro-1H-indene-5-carboximidamide |
|---|---|
| PubChem CID | 174307442 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-[[4-amino-3-(methyliminomethyl)buta-1,3-dien-2-yl]amino]-N'-methyl-N-pent-1-en-3-ylidene-2,3,4,5-tetrahydro-1H-indene-5-carboximidamide |
| SMILES | C=C/C(CC)=N\C(=N/C)C1C=CC2=C(CCC2NC(=C)C(=CN)/C=N/C)C1 |
| InChI | InChI=1S/C22H31N5/c1-6-19(7-2)27-22(25-5)17-8-10-20-16(12-17)9-11-21(20)26-15(3)18(13-23)14-24-4/h6,8,10,13-14,17,21,26H,1,3,7,9,11-12,23H2,2,4-5H3/b18-13?,24-14+,25-22-,27-19+ |
| InChIKey | KGYZHFRDOQSNGO-COHGSRDGSA-N |
| XLogP | 3.73 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|