About 8-chloro-5,6-dihydrochrysene
8-chloro-5,6-dihydrochrysene (PubChem CID 174309529) has the molecular formula C18H13Cl
and a molecular weight of 264.75 g/mol. Its IUPAC name is 8-chloro-5,6-dihydrochrysene.
Molecular Properties
| Compound Name | 8-chloro-5,6-dihydrochrysene |
| PubChem CID | 174309529 |
| Molecular Formula | C18H13Cl |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 8-chloro-5,6-dihydrochrysene |
| SMILES | Clc1ccc2c(c1)CCc1c-2ccc2ccccc12 |
| InChI | InChI=1S/C18H13Cl/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h1-5,7-8,10-11H,6,9H2 |
| InChIKey | YOIGQUWONXNLRI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8-chloro-5,6-dihydrochrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5,6-dihydrochrysene?
The IUPAC name of 8-chloro-5,6-dihydrochrysene (CID 174309529) is 8-chloro-5,6-dihydrochrysene.
What is the SMILES notation for 8-chloro-5,6-dihydrochrysene?
The canonical SMILES for 8-chloro-5,6-dihydrochrysene is Clc1ccc2c(c1)CCc1c-2ccc2ccccc12.
What is the InChIKey of 8-chloro-5,6-dihydrochrysene?
The InChIKey is YOIGQUWONXNLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h1-5,7-8,10-11H,6,9H2.
What are the key properties of 8-chloro-5,6-dihydrochrysene?
8-chloro-5,6-dihydrochrysene has a molecular weight of 264.75 g/mol, XLogP of 5.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5,6-dihydrochrysene is sourced from PubChem (CID 174309529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).