About 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine
3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine (PubChem CID 174310431) has the molecular formula C8H14N2OS3
and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine |
| PubChem CID | 174310431 |
| Molecular Formula | C8H14N2OS3 |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine |
| SMILES | C1CSCN1.CCN1C(=O)CSC1=S |
| InChI | InChI=1S/C5H7NOS2.C3H7NS/c1-2-6-4(7)3-9-5(6)8;1-2-5-3-4-1/h2-3H2,1H3;4H,1-3H2 |
| InChIKey | QFOJKABUXDTUAI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine?
The IUPAC name of 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine (CID 174310431) is 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine.
What is the SMILES notation for 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine?
The canonical SMILES for 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine is C1CSCN1.CCN1C(=O)CSC1=S.
What is the InChIKey of 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine?
The InChIKey is QFOJKABUXDTUAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS2.C3H7NS/c1-2-6-4(7)3-9-5(6)8;1-2-5-3-4-1/h2-3H2,1H3;4H,1-3H2.
What are the key properties of 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine?
3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine has a molecular weight of 250.41 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one;1,3-thiazolidine is sourced from PubChem (CID 174310431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).