About bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine
bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine (PubChem CID 174310958) has the molecular formula C8H6BrF3N2
and a molecular weight of 267.05 g/mol. Its IUPAC name is bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 174310958 |
| Molecular Formula | C8H6BrF3N2 |
| Molecular Weight | 267.05 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine |
| SMILES | FC(F)(F)Br.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.CBrF3/c1-2-6-3-5-9-7(6)8-4-1;2-1(3,4)5/h1-5H,(H,8,9); |
| InChIKey | IVNUNZYEXLIZLF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.05 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine (CID 174310958) is bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine is FC(F)(F)Br.c1cnc2[nH]ccc2c1.
What is the InChIKey of bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine?
The InChIKey is IVNUNZYEXLIZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.CBrF3/c1-2-6-3-5-9-7(6)8-4-1;2-1(3,4)5/h1-5H,(H,8,9);.
What are the key properties of bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine?
bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine has a molecular weight of 267.05 g/mol, XLogP of 3.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(trifluoro)methane;1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 174310958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).