About (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole
(3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole (PubChem CID 174311014) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole.
Molecular Properties
| Compound Name | (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole |
| PubChem CID | 174311014 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole |
| SMILES | C=C/C=C1/CN=C(C)/C1=C/C=C |
| InChI | InChI=1S/C11H13N/c1-4-6-10-8-12-9(3)11(10)7-5-2/h4-7H,1-2,8H2,3H3/b10-6-,11-7- |
| InChIKey | FAEBSOJIVYWNNI-SQXCDDPUSA-N |
| XLogP | 2.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole?
The IUPAC name of (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole (CID 174311014) is (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole.
What is the SMILES notation for (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole?
The canonical SMILES for (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole is C=C/C=C1/CN=C(C)/C1=C/C=C.
What is the InChIKey of (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole?
The InChIKey is FAEBSOJIVYWNNI-SQXCDDPUSA-N. The full InChI is InChI=1S/C11H13N/c1-4-6-10-8-12-9(3)11(10)7-5-2/h4-7H,1-2,8H2,3H3/b10-6-,11-7-.
What are the key properties of (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole?
(3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole has a molecular weight of 159.23 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-5-methyl-3,4-bis(prop-2-enylidene)-2H-pyrrole is sourced from PubChem (CID 174311014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).