About 4-methyl-4,6-di(propan-2-yl)oxazine
4-methyl-4,6-di(propan-2-yl)oxazine (PubChem CID 174311289) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-methyl-4,6-di(propan-2-yl)oxazine.
Molecular Properties
| Compound Name | 4-methyl-4,6-di(propan-2-yl)oxazine |
| PubChem CID | 174311289 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-methyl-4,6-di(propan-2-yl)oxazine |
| SMILES | CC(C)C1=CC(C)(C(C)C)C=NO1 |
| InChI | InChI=1S/C11H19NO/c1-8(2)10-6-11(5,9(3)4)7-12-13-10/h6-9H,1-5H3 |
| InChIKey | ZJXWRDZKEJRFIC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-4,6-di(propan-2-yl)oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4,6-di(propan-2-yl)oxazine?
The IUPAC name of 4-methyl-4,6-di(propan-2-yl)oxazine (CID 174311289) is 4-methyl-4,6-di(propan-2-yl)oxazine.
What is the SMILES notation for 4-methyl-4,6-di(propan-2-yl)oxazine?
The canonical SMILES for 4-methyl-4,6-di(propan-2-yl)oxazine is CC(C)C1=CC(C)(C(C)C)C=NO1.
What is the InChIKey of 4-methyl-4,6-di(propan-2-yl)oxazine?
The InChIKey is ZJXWRDZKEJRFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-8(2)10-6-11(5,9(3)4)7-12-13-10/h6-9H,1-5H3.
What are the key properties of 4-methyl-4,6-di(propan-2-yl)oxazine?
4-methyl-4,6-di(propan-2-yl)oxazine has a molecular weight of 181.28 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,6-di(propan-2-yl)oxazine is sourced from PubChem (CID 174311289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).