About 2-acetyloxyethyl(trimethyl)azanium;1H-indole
2-acetyloxyethyl(trimethyl)azanium;1H-indole (PubChem CID 174311440) has the molecular formula C15H23N2O2+
and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-acetyloxyethyl(trimethyl)azanium;1H-indole.
Molecular Properties
| Compound Name | 2-acetyloxyethyl(trimethyl)azanium;1H-indole |
| PubChem CID | 174311440 |
| Molecular Formula | C15H23N2O2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 2-acetyloxyethyl(trimethyl)azanium;1H-indole |
| SMILES | CC(=O)OCC[N+](C)(C)C.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C7H16NO2/c1-2-4-8-7(3-1)5-6-9-8;1-7(9)10-6-5-8(2,3)4/h1-6,9H;5-6H2,1-4H3/q;+1 |
| InChIKey | IPLAKUTYJNRJFG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl(trimethyl)azanium;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl(trimethyl)azanium;1H-indole?
The IUPAC name of 2-acetyloxyethyl(trimethyl)azanium;1H-indole (CID 174311440) is 2-acetyloxyethyl(trimethyl)azanium;1H-indole.
What is the SMILES notation for 2-acetyloxyethyl(trimethyl)azanium;1H-indole?
The canonical SMILES for 2-acetyloxyethyl(trimethyl)azanium;1H-indole is CC(=O)OCC[N+](C)(C)C.c1ccc2[nH]ccc2c1.
What is the InChIKey of 2-acetyloxyethyl(trimethyl)azanium;1H-indole?
The InChIKey is IPLAKUTYJNRJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H16NO2/c1-2-4-8-7(3-1)5-6-9-8;1-7(9)10-6-5-8(2,3)4/h1-6,9H;5-6H2,1-4H3/q;+1.
What are the key properties of 2-acetyloxyethyl(trimethyl)azanium;1H-indole?
2-acetyloxyethyl(trimethyl)azanium;1H-indole has a molecular weight of 263.36 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl(trimethyl)azanium;1H-indole is sourced from PubChem (CID 174311440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).