(Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride

C7H9F2N — CID 174311553

IUPAC(Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride
SMILESC=C/N=C(F)/C=C\CCF
InChIInChI=1S/C7H9F2N/c1-2-10-7(9)5-3-4-6-8/h2-3,5H,1,4,6H2/b5-3-,10-7-
InChIKeyGOEYITDAZXIBTP-TYWVWOHTSA-N
MW145.15 g/mol
LogP2.41
Rot. Bonds4

About (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride

(Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride (PubChem CID 174311553) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride.

Molecular Properties

Compound Name(Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride
PubChem CID174311553
Molecular FormulaC7H9F2N
Molecular Weight145.15 g/mol
Exact Mass145.07
IUPAC Name(Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride
SMILESC=C/N=C(F)/C=C\CCF
InChIInChI=1S/C7H9F2N/c1-2-10-7(9)5-3-4-6-8/h2-3,5H,1,4,6H2/b5-3-,10-7-
InChIKeyGOEYITDAZXIBTP-TYWVWOHTSA-N
XLogP2.41
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.15
LogP ≤ 52.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride?
The IUPAC name of (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride (CID 174311553) is (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride.
What is the SMILES notation for (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride?
The canonical SMILES for (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride is C=C/N=C(F)/C=C\CCF.
What is the InChIKey of (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride?
The InChIKey is GOEYITDAZXIBTP-TYWVWOHTSA-N. The full InChI is InChI=1S/C7H9F2N/c1-2-10-7(9)5-3-4-6-8/h2-3,5H,1,4,6H2/b5-3-,10-7-.
What are the key properties of (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride?
(Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride has a molecular weight of 145.15 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethenyl-5-fluoropent-2-enimidoyl fluoride is sourced from PubChem (CID 174311553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).