C21H24N2O4 — CID 174312166
3-ethenyl-4-[3-[1-(4-ethenyl-2,5-dioxopyrrol-3-yl)ethyl]-4-methylpent-3-en-2-yl]-1-methylpyrrole-2,5-dione (PubChem CID 174312166) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-ethenyl-4-[3-[1-(4-ethenyl-2,5-dioxopyrrol-3-yl)ethyl]-4-methylpent-3-en-2-yl]-1-methylpyrrole-2,5-dione.
| Compound Name | 3-ethenyl-4-[3-[1-(4-ethenyl-2,5-dioxopyrrol-3-yl)ethyl]-4-methylpent-3-en-2-yl]-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 174312166 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-ethenyl-4-[3-[1-(4-ethenyl-2,5-dioxopyrrol-3-yl)ethyl]-4-methylpent-3-en-2-yl]-1-methylpyrrole-2,5-dione |
| SMILES | C=CC1=C(C(C)C(=C(C)C)C(C)C2=C(C=C)C(=O)N(C)C2=O)C(=O)NC1=O |
| InChI | InChI=1S/C21H24N2O4/c1-8-13-16(19(25)22-18(13)24)11(5)15(10(3)4)12(6)17-14(9-2)20(26)23(7)21(17)27/h8-9,11-12H,1-2H2,3-7H3,(H,22,24,25) |
| InChIKey | BJOLRHSTUHNMJD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|