About 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium
2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium (PubChem CID 174312655) has the molecular formula C24H32Cl2Zr
and a molecular weight of 482.65 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium.
Molecular Properties
| Compound Name | 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium |
| PubChem CID | 174312655 |
| Molecular Formula | C24H32Cl2Zr |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium |
| SMILES | CCC1c2cc(C(C)(C)C)ccc2-c2c(C)cc(C(C)(C)C)cc21.Cl[Zr]Cl |
| InChI | InChI=1S/C24H32.2ClH.Zr/c1-9-18-20-13-16(23(3,4)5)10-11-19(20)22-15(2)12-17(14-21(18)22)24(6,7)8;;;/h10-14,18H,9H2,1-8H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YKHDLOPIVXDPLH-UHFFFAOYSA-L |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium?
The IUPAC name of 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium (CID 174312655) is 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium.
What is the SMILES notation for 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium?
The canonical SMILES for 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium is CCC1c2cc(C(C)(C)C)ccc2-c2c(C)cc(C(C)(C)C)cc21.Cl[Zr]Cl.
What is the InChIKey of 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium?
The InChIKey is YKHDLOPIVXDPLH-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H32.2ClH.Zr/c1-9-18-20-13-16(23(3,4)5)10-11-19(20)22-15(2)12-17(14-21(18)22)24(6,7)8;;;/h10-14,18H,9H2,1-8H3;2*1H;/q;;;+2/p-2.
What are the key properties of 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium?
2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium has a molecular weight of 482.65 g/mol, XLogP of 8.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butyl-9-ethyl-4-methyl-9H-fluorene;dichlorozirconium is sourced from PubChem (CID 174312655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).