About 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride
3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 174313050) has the molecular formula C8H5ClF4O
and a molecular weight of 228.57 g/mol. Its IUPAC name is 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride |
| PubChem CID | 174313050 |
| Molecular Formula | C8H5ClF4O |
| Molecular Weight | 228.57 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride |
| SMILES | O=C(Cl)C1C=C(F)C=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H5ClF4O/c9-7(14)4-1-5(8(11,12)13)3-6(10)2-4/h2-4H,1H2 |
| InChIKey | LIKYTDVOTNMFOL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride?
The IUPAC name of 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride (CID 174313050) is 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride.
What is the SMILES notation for 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride?
The canonical SMILES for 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride is O=C(Cl)C1C=C(F)C=C(C(F)(F)F)C1.
What is the InChIKey of 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride?
The InChIKey is LIKYTDVOTNMFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF4O/c9-7(14)4-1-5(8(11,12)13)3-6(10)2-4/h2-4H,1H2.
What are the key properties of 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride?
3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride has a molecular weight of 228.57 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbonyl chloride is sourced from PubChem (CID 174313050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).