About 1H-isothiochromen-1-yl formate
1H-isothiochromen-1-yl formate (PubChem CID 174313609) has the molecular formula C10H8O2S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 1H-isothiochromen-1-yl formate.
Molecular Properties
| Compound Name | 1H-isothiochromen-1-yl formate |
| PubChem CID | 174313609 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 1H-isothiochromen-1-yl formate |
| SMILES | O=COC1SC=Cc2ccccc21 |
| InChI | InChI=1S/C10H8O2S/c11-7-12-10-9-4-2-1-3-8(9)5-6-13-10/h1-7,10H |
| InChIKey | XYCXPYJSTISFJT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-isothiochromen-1-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-isothiochromen-1-yl formate?
The IUPAC name of 1H-isothiochromen-1-yl formate (CID 174313609) is 1H-isothiochromen-1-yl formate.
What is the SMILES notation for 1H-isothiochromen-1-yl formate?
The canonical SMILES for 1H-isothiochromen-1-yl formate is O=COC1SC=Cc2ccccc21.
What is the InChIKey of 1H-isothiochromen-1-yl formate?
The InChIKey is XYCXPYJSTISFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S/c11-7-12-10-9-4-2-1-3-8(9)5-6-13-10/h1-7,10H.
What are the key properties of 1H-isothiochromen-1-yl formate?
1H-isothiochromen-1-yl formate has a molecular weight of 192.24 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-isothiochromen-1-yl formate is sourced from PubChem (CID 174313609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).