C25H15ClF5N3O3 — CID 174313731
N-[7-(2-chloro-5-fluorophenyl)-2,9-dioxo-3,4,7,8-tetrahydro-1H-pyrrolo[3,4-h]quinolin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 174313731) has the molecular formula C25H15ClF5N3O3 and a molecular weight of 535.86 g/mol. Its IUPAC name is N-[7-(2-chloro-5-fluorophenyl)-2,9-dioxo-3,4,7,8-tetrahydro-1H-pyrrolo[3,4-h]quinolin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[7-(2-chloro-5-fluorophenyl)-2,9-dioxo-3,4,7,8-tetrahydro-1H-pyrrolo[3,4-h]quinolin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174313731 |
| Molecular Formula | C25H15ClF5N3O3 |
| Molecular Weight | 535.86 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | N-[7-(2-chloro-5-fluorophenyl)-2,9-dioxo-3,4,7,8-tetrahydro-1H-pyrrolo[3,4-h]quinolin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C1CCc2cc(NC(=O)c3cc(F)cc(C(F)(F)F)c3)c3c(c2N1)C(=O)NC3c1cc(F)ccc1Cl |
| InChI | InChI=1S/C25H15ClF5N3O3/c26-16-3-2-13(27)9-15(16)22-19-17(7-10-1-4-18(35)33-21(10)20(19)24(37)34-22)32-23(36)11-5-12(25(29,30)31)8-14(28)6-11/h2-3,5-9,22H,1,4H2,(H,32,36)(H,33,35)(H,34,37) |
| InChIKey | XSJROSABTRMHHR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |