About 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine
1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine (PubChem CID 174313948) has the molecular formula C16H18ClN3
and a molecular weight of 287.79 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine |
| PubChem CID | 174313948 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)C(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3/c1-19-16(18)20(2)15(12-8-4-3-5-9-12)13-10-6-7-11-14(13)17/h3-11,15H,1-2H3,(H2,18,19) |
| InChIKey | XLAIDQUOBVVCJW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine?
The IUPAC name of 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine (CID 174313948) is 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine.
What is the SMILES notation for 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine?
The canonical SMILES for 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine is C/N=C(\N)N(C)C(c1ccccc1)c1ccccc1Cl.
What is the InChIKey of 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine?
The InChIKey is XLAIDQUOBVVCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3/c1-19-16(18)20(2)15(12-8-4-3-5-9-12)13-10-6-7-11-14(13)17/h3-11,15H,1-2H3,(H2,18,19).
What are the key properties of 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine?
1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine has a molecular weight of 287.79 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chlorophenyl)-phenylmethyl]-1,2-dimethylguanidine is sourced from PubChem (CID 174313948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).