C28H34N4O4 — CID 174314760
ethyl 1-amino-4-oxaldehydoyl-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-2,4-dihydroquinazoline-7-carboxylate (PubChem CID 174314760) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 1-amino-4-oxaldehydoyl-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-2,4-dihydroquinazoline-7-carboxylate.
| Compound Name | ethyl 1-amino-4-oxaldehydoyl-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-2,4-dihydroquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 174314760 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | ethyl 1-amino-4-oxaldehydoyl-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-2,4-dihydroquinazoline-7-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)N(N)CN(CCCCN1CC=C(c3ccccc3)CC1)C2C(=O)C=O |
| InChI | InChI=1S/C28H34N4O4/c1-2-36-28(35)23-10-11-24-25(18-23)32(29)20-31(27(24)26(34)19-33)15-7-6-14-30-16-12-22(13-17-30)21-8-4-3-5-9-21/h3-5,8-12,18-19,27H,2,6-7,13-17,20,29H2,1H3 |
| InChIKey | WBIARNXJVAYCEQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|