C17H21N3O4S2 — CID 17431538
2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 17431538) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17431538 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1N1CCOCC1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-19(26(22,23)17-7-4-12-25-17)13-16(21)18-14-5-2-3-6-15(14)20-8-10-24-11-9-20/h2-7,12H,8-11,13H2,1H3,(H,18,21) |
| InChIKey | FURLPKOGOGJFSI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |