C14H18FIN4O2 — CID 174315390
1-[(3aR,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(iodomethoxy)propan-1-one (PubChem CID 174315390) has the molecular formula C14H18FIN4O2 and a molecular weight of 420.23 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(iodomethoxy)propan-1-one.
| Compound Name | 1-[(3aR,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(iodomethoxy)propan-1-one |
|---|---|
| PubChem CID | 174315390 |
| Molecular Formula | C14H18FIN4O2 |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 1-[(3aR,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(iodomethoxy)propan-1-one |
| SMILES | O=C(CCOCI)N1CC[C@@H]2[C@H]1CCN2c1ncc(F)cn1 |
| InChI | InChI=1S/C14H18FIN4O2/c15-10-7-17-14(18-8-10)20-5-2-11-12(20)1-4-19(11)13(21)3-6-22-9-16/h7-8,11-12H,1-6,9H2/t11-,12-/m1/s1 |
| InChIKey | IURLFMGSBBQYSJ-VXGBXAGGSA-N |
| XLogP | 1.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|