C12H25N — CID 174315397
1-(2,3-dimethylbutyl)-3-methylpiperidine (PubChem CID 174315397) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 1-(2,3-dimethylbutyl)-3-methylpiperidine.
| Compound Name | 1-(2,3-dimethylbutyl)-3-methylpiperidine |
|---|---|
| PubChem CID | 174315397 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 1-(2,3-dimethylbutyl)-3-methylpiperidine |
| SMILES | CC1CCCN(CC(C)C(C)C)C1 |
| InChI | InChI=1S/C12H25N/c1-10(2)12(4)9-13-7-5-6-11(3)8-13/h10-12H,5-9H2,1-4H3 |
| InChIKey | QIEDUYYQEIJBBZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |