C24H37F3N4O2 — CID 174315411
1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(3,3-dimethyl-2-propylpentoxy)propan-1-one (PubChem CID 174315411) has the molecular formula C24H37F3N4O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(3,3-dimethyl-2-propylpentoxy)propan-1-one.
| Compound Name | 1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(3,3-dimethyl-2-propylpentoxy)propan-1-one |
|---|---|
| PubChem CID | 174315411 |
| Molecular Formula | C24H37F3N4O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 1-[(3aR,6aR)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-3-(3,3-dimethyl-2-propylpentoxy)propan-1-one |
| SMILES | CCCC(COCCC(=O)N1CC[C@@H]2[C@H]1CCN2c1ncc(C(F)(F)F)cn1)C(C)(C)CC |
| InChI | InChI=1S/C24H37F3N4O2/c1-5-7-17(23(3,4)6-2)16-33-13-10-21(32)30-11-8-20-19(30)9-12-31(20)22-28-14-18(15-29-22)24(25,26)27/h14-15,17,19-20H,5-13,16H2,1-4H3/t17?,19-,20-/m1/s1 |
| InChIKey | HRCSRTPAPYXWAK-IPNZSQQUSA-N |
| XLogP | 4.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|