C12H16F3N5 — CID 174315898
(3aR,6aR)-N-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,5,6-hexahydropyrrolo[3,2-b]pyrrol-6a-amine (PubChem CID 174315898) has the molecular formula C12H16F3N5 and a molecular weight of 287.29 g/mol. Its IUPAC name is (3aR,6aR)-N-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,5,6-hexahydropyrrolo[3,2-b]pyrrol-6a-amine.
| Compound Name | (3aR,6aR)-N-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,5,6-hexahydropyrrolo[3,2-b]pyrrol-6a-amine |
|---|---|
| PubChem CID | 174315898 |
| Molecular Formula | C12H16F3N5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (3aR,6aR)-N-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,3a,5,6-hexahydropyrrolo[3,2-b]pyrrol-6a-amine |
| SMILES | CN[C@@]12CCN(c3ncc(C(F)(F)F)cn3)[C@@H]1CCN2 |
| InChI | InChI=1S/C12H16F3N5/c1-16-11-3-5-20(9(11)2-4-19-11)10-17-6-8(7-18-10)12(13,14)15/h6-7,9,16,19H,2-5H2,1H3/t9-,11-/m1/s1 |
| InChIKey | HYVHDMMMDNPKNL-MWLCHTKSSA-N |
| XLogP | 0.98 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |