About benzene;1H-imidazole;piperazine
benzene;1H-imidazole;piperazine (PubChem CID 174316077) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is benzene;1H-imidazole;piperazine.
Molecular Properties
| Compound Name | benzene;1H-imidazole;piperazine |
| PubChem CID | 174316077 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | benzene;1H-imidazole;piperazine |
| SMILES | C1CNCCN1.c1c[nH]cn1.c1ccccc1 |
| InChI | InChI=1S/C6H6.C4H10N2.C3H4N2/c1-2-4-6-5-3-1;1-2-6-4-3-5-1;1-2-5-3-4-1/h1-6H;5-6H,1-4H2;1-3H,(H,4,5) |
| InChIKey | SZRTWJFJNFRCEQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;1H-imidazole;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1H-imidazole;piperazine?
The IUPAC name of benzene;1H-imidazole;piperazine (CID 174316077) is benzene;1H-imidazole;piperazine.
What is the SMILES notation for benzene;1H-imidazole;piperazine?
The canonical SMILES for benzene;1H-imidazole;piperazine is C1CNCCN1.c1c[nH]cn1.c1ccccc1.
What is the InChIKey of benzene;1H-imidazole;piperazine?
The InChIKey is SZRTWJFJNFRCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C4H10N2.C3H4N2/c1-2-4-6-5-3-1;1-2-6-4-3-5-1;1-2-5-3-4-1/h1-6H;5-6H,1-4H2;1-3H,(H,4,5).
What are the key properties of benzene;1H-imidazole;piperazine?
benzene;1H-imidazole;piperazine has a molecular weight of 232.33 g/mol, XLogP of 1.28, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1H-imidazole;piperazine is sourced from PubChem (CID 174316077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).