C16H22N2O2 — CID 174316128
N-[4-[(E)-2-cyclopentylprop-1-enyl]-6-methoxy-2-methyl-3-pyridinyl]formamide (PubChem CID 174316128) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[4-[(E)-2-cyclopentylprop-1-enyl]-6-methoxy-2-methyl-3-pyridinyl]formamide.
| Compound Name | N-[4-[(E)-2-cyclopentylprop-1-enyl]-6-methoxy-2-methyl-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 174316128 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[4-[(E)-2-cyclopentylprop-1-enyl]-6-methoxy-2-methyl-3-pyridinyl]formamide |
| SMILES | COc1cc(/C=C(\C)C2CCCC2)c(NC=O)c(C)n1 |
| InChI | InChI=1S/C16H22N2O2/c1-11(13-6-4-5-7-13)8-14-9-15(20-3)18-12(2)16(14)17-10-19/h8-10,13H,4-7H2,1-3H3,(H,17,19)/b11-8+ |
| InChIKey | VCSAGJWBTBNAGW-DHZHZOJOSA-N |
| XLogP | 3.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|