C19H28O3 — CID 174316403
(1E,3R,8R,10R,14S)-8-hydroxy-14-(methoxymethyl)-3,6,10-trimethyltricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one (PubChem CID 174316403) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1E,3R,8R,10R,14S)-8-hydroxy-14-(methoxymethyl)-3,6,10-trimethyltricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one.
| Compound Name | (1E,3R,8R,10R,14S)-8-hydroxy-14-(methoxymethyl)-3,6,10-trimethyltricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one |
|---|---|
| PubChem CID | 174316403 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1E,3R,8R,10R,14S)-8-hydroxy-14-(methoxymethyl)-3,6,10-trimethyltricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one |
| SMILES | COC[C@H]1CCC2/C1=C\[C@@]1(C)CCC(C)=C1[C@@H](O)C(=O)[C@@H]2C |
| InChI | InChI=1S/C19H28O3/c1-11-7-8-19(3)9-15-13(10-22-4)5-6-14(15)12(2)17(20)18(21)16(11)19/h9,12-14,18,21H,5-8,10H2,1-4H3/b15-9-/t12-,13-,14?,18-,19-/m1/s1 |
| InChIKey | PCKBCPXUUYFQPH-KPIUIKAESA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|