C18H22F4 — CID 174316638
(3E,10E)-3-(fluoromethyl)-7,10-dimethyl-5-(trifluoromethyl)tetradeca-3,10-dien-1,13-diyne (PubChem CID 174316638) has the molecular formula C18H22F4 and a molecular weight of 314.37 g/mol. Its IUPAC name is (3E,10E)-3-(fluoromethyl)-7,10-dimethyl-5-(trifluoromethyl)tetradeca-3,10-dien-1,13-diyne.
| Compound Name | (3E,10E)-3-(fluoromethyl)-7,10-dimethyl-5-(trifluoromethyl)tetradeca-3,10-dien-1,13-diyne |
|---|---|
| PubChem CID | 174316638 |
| Molecular Formula | C18H22F4 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3E,10E)-3-(fluoromethyl)-7,10-dimethyl-5-(trifluoromethyl)tetradeca-3,10-dien-1,13-diyne |
| SMILES | C#CC/C=C(\C)CCC(C)CC(/C=C(\C#C)CF)C(F)(F)F |
| InChI | InChI=1S/C18H22F4/c1-5-7-8-14(3)9-10-15(4)11-17(18(20,21)22)12-16(6-2)13-19/h1-2,8,12,15,17H,7,9-11,13H2,3-4H3/b14-8+,16-12+ |
| InChIKey | PNIGVCLZXUXBAS-WCDFYNJISA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|