C15H26N2 — CID 174316939
4-methyl-N,1-di(propan-2-yl)-4,5,6,7-tetrahydro-3H-indol-2-imine (PubChem CID 174316939) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-methyl-N,1-di(propan-2-yl)-4,5,6,7-tetrahydro-3H-indol-2-imine.
| Compound Name | 4-methyl-N,1-di(propan-2-yl)-4,5,6,7-tetrahydro-3H-indol-2-imine |
|---|---|
| PubChem CID | 174316939 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 4-methyl-N,1-di(propan-2-yl)-4,5,6,7-tetrahydro-3H-indol-2-imine |
| SMILES | CC(C)/N=C1\CC2=C(CCCC2C)N1C(C)C |
| InChI | InChI=1S/C15H26N2/c1-10(2)16-15-9-13-12(5)7-6-8-14(13)17(15)11(3)4/h10-12H,6-9H2,1-5H3/b16-15+ |
| InChIKey | AJUPXTBUBXTUMB-FOCLMDBBSA-N |
| XLogP | 3.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|