About 3-(1,3-thiazolidin-2-yl)-1,2-oxazole
3-(1,3-thiazolidin-2-yl)-1,2-oxazole (PubChem CID 174317001) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 3-(1,3-thiazolidin-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(1,3-thiazolidin-2-yl)-1,2-oxazole |
| PubChem CID | 174317001 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-(1,3-thiazolidin-2-yl)-1,2-oxazole |
| SMILES | c1cc(C2NCCS2)no1 |
| InChI | InChI=1S/C6H8N2OS/c1-3-9-8-5(1)6-7-2-4-10-6/h1,3,6-7H,2,4H2 |
| InChIKey | SEYBXEZWFKDCIE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-thiazolidin-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazolidin-2-yl)-1,2-oxazole?
The IUPAC name of 3-(1,3-thiazolidin-2-yl)-1,2-oxazole (CID 174317001) is 3-(1,3-thiazolidin-2-yl)-1,2-oxazole.
What is the SMILES notation for 3-(1,3-thiazolidin-2-yl)-1,2-oxazole?
The canonical SMILES for 3-(1,3-thiazolidin-2-yl)-1,2-oxazole is c1cc(C2NCCS2)no1.
What is the InChIKey of 3-(1,3-thiazolidin-2-yl)-1,2-oxazole?
The InChIKey is SEYBXEZWFKDCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-3-9-8-5(1)6-7-2-4-10-6/h1,3,6-7H,2,4H2.
What are the key properties of 3-(1,3-thiazolidin-2-yl)-1,2-oxazole?
3-(1,3-thiazolidin-2-yl)-1,2-oxazole has a molecular weight of 156.21 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazolidin-2-yl)-1,2-oxazole is sourced from PubChem (CID 174317001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).