C16H30N2 — CID 174317023
6-methyl-N,2-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-imine (PubChem CID 174317023) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 6-methyl-N,2-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-imine.
| Compound Name | 6-methyl-N,2-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-imine |
|---|---|
| PubChem CID | 174317023 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 6-methyl-N,2-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydroisoquinolin-1-imine |
| SMILES | CC1CCC2/C(=N\C(C)C)N(C(C)C)CCC2C1 |
| InChI | InChI=1S/C16H30N2/c1-11(2)17-16-15-7-6-13(5)10-14(15)8-9-18(16)12(3)4/h11-15H,6-10H2,1-5H3/b17-16+ |
| InChIKey | DJXXUALSCCOFFR-WUKNDPDISA-N |
| XLogP | 3.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|