C11H22N4S2 — CID 174317178
6-amino-1,6-dibutyl-1,3,5-triazinane-2,4-dithione (PubChem CID 174317178) has the molecular formula C11H22N4S2 and a molecular weight of 274.46 g/mol. Its IUPAC name is 6-amino-1,6-dibutyl-1,3,5-triazinane-2,4-dithione.
| Compound Name | 6-amino-1,6-dibutyl-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 174317178 |
| Molecular Formula | C11H22N4S2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-amino-1,6-dibutyl-1,3,5-triazinane-2,4-dithione |
| SMILES | CCCCN1C(=S)NC(=S)NC1(N)CCCC |
| InChI | InChI=1S/C11H22N4S2/c1-3-5-7-11(12)14-9(16)13-10(17)15(11)8-6-4-2/h3-8,12H2,1-2H3,(H2,13,14,16,17) |
| InChIKey | RYUAKHHURCDDED-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|