C25H37N5OS — CID 17431744
1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 17431744) has the molecular formula C25H37N5OS and a molecular weight of 455.67 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 17431744 |
| Molecular Formula | C25H37N5OS |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-[[4-benzyl-5-[1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | CCC(c1nnc(SCC(=O)N2CCC3CCCCC3C2)n1Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C25H37N5OS/c1-4-22(28(2)3)24-26-27-25(30(24)16-19-10-6-5-7-11-19)32-18-23(31)29-15-14-20-12-8-9-13-21(20)17-29/h5-7,10-11,20-22H,4,8-9,12-18H2,1-3H3 |
| InChIKey | QBHDIZKZJZNFKN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |