About N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine
N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine (PubChem CID 174317493) has the molecular formula C12H27N3O
and a molecular weight of 229.37 g/mol. Its IUPAC name is N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine |
| PubChem CID | 174317493 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine |
| SMILES | C=C(COCCNCCN(C)CCC)NC |
| InChI | InChI=1S/C12H27N3O/c1-5-8-15(4)9-6-14-7-10-16-11-12(2)13-3/h13-14H,2,5-11H2,1,3-4H3 |
| InChIKey | LHPZPHIFRUGEMG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine?
The IUPAC name of N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine (CID 174317493) is N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine?
The canonical SMILES for N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine is C=C(COCCNCCN(C)CCC)NC.
What is the InChIKey of N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine?
The InChIKey is LHPZPHIFRUGEMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3O/c1-5-8-15(4)9-6-14-7-10-16-11-12(2)13-3/h13-14H,2,5-11H2,1,3-4H3.
What are the key properties of N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine?
N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine has a molecular weight of 229.37 g/mol, XLogP of 0.67, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-[2-[2-(methylamino)prop-2-enoxy]ethyl]-N'-propylethane-1,2-diamine is sourced from PubChem (CID 174317493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).