About 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one
1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one (PubChem CID 174317957) has the molecular formula C19H18Br2F2O5S2
and a molecular weight of 588.29 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one.
Molecular Properties
| Compound Name | 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one |
| PubChem CID | 174317957 |
| Molecular Formula | C19H18Br2F2O5S2 |
| Molecular Weight | 588.29 g/mol |
| Exact Mass | 585.89 |
| IUPAC Name | 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one |
| SMILES | CS(=O)(=O)c1cc(C(CBr)C(=O)C(CBr)c2ccc(F)c(S(C)(=O)=O)c2)ccc1F |
| InChI | InChI=1S/C19H18Br2F2O5S2/c1-29(25,26)17-7-11(3-5-15(17)22)13(9-20)19(24)14(10-21)12-4-6-16(23)18(8-12)30(2,27)28/h3-8,13-14H,9-10H2,1-2H3 |
| InChIKey | AXIZLIRSEYHFAU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 588.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one?
The IUPAC name of 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one (CID 174317957) is 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one.
What is the SMILES notation for 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one?
The canonical SMILES for 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one is CS(=O)(=O)c1cc(C(CBr)C(=O)C(CBr)c2ccc(F)c(S(C)(=O)=O)c2)ccc1F.
What is the InChIKey of 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one?
The InChIKey is AXIZLIRSEYHFAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Br2F2O5S2/c1-29(25,26)17-7-11(3-5-15(17)22)13(9-20)19(24)14(10-21)12-4-6-16(23)18(8-12)30(2,27)28/h3-8,13-14H,9-10H2,1-2H3.
What are the key properties of 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one?
1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one has a molecular weight of 588.29 g/mol, XLogP of 4.00, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibromo-2,4-bis(4-fluoro-3-methylsulfonylphenyl)pentan-3-one is sourced from PubChem (CID 174317957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).