About chromium;1,3-dimethylpyrazole
chromium;1,3-dimethylpyrazole (PubChem CID 174318008) has the molecular formula C5H8CrN2
and a molecular weight of 148.13 g/mol. Its IUPAC name is chromium;1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | chromium;1,3-dimethylpyrazole |
| PubChem CID | 174318008 |
| Molecular Formula | C5H8CrN2 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | chromium;1,3-dimethylpyrazole |
| SMILES | Cc1ccn(C)n1.[Cr] |
| InChI | InChI=1S/C5H8N2.Cr/c1-5-3-4-7(2)6-5;/h3-4H,1-2H3; |
| InChIKey | GQOPONNEEAZFLP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromium;1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;1,3-dimethylpyrazole?
The IUPAC name of chromium;1,3-dimethylpyrazole (CID 174318008) is chromium;1,3-dimethylpyrazole.
What is the SMILES notation for chromium;1,3-dimethylpyrazole?
The canonical SMILES for chromium;1,3-dimethylpyrazole is Cc1ccn(C)n1.[Cr].
What is the InChIKey of chromium;1,3-dimethylpyrazole?
The InChIKey is GQOPONNEEAZFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.Cr/c1-5-3-4-7(2)6-5;/h3-4H,1-2H3;.
What are the key properties of chromium;1,3-dimethylpyrazole?
chromium;1,3-dimethylpyrazole has a molecular weight of 148.13 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;1,3-dimethylpyrazole is sourced from PubChem (CID 174318008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).