C14H23N3 — CID 174318397
1-N'-[(Z)-2-(ethylideneamino)ethenyl]-1-N-[(1Z,5E)-3-methylhepta-1,5-dienyl]ethene-1,1-diamine (PubChem CID 174318397) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-N'-[(Z)-2-(ethylideneamino)ethenyl]-1-N-[(1Z,5E)-3-methylhepta-1,5-dienyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[(Z)-2-(ethylideneamino)ethenyl]-1-N-[(1Z,5E)-3-methylhepta-1,5-dienyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 174318397 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1-N'-[(Z)-2-(ethylideneamino)ethenyl]-1-N-[(1Z,5E)-3-methylhepta-1,5-dienyl]ethene-1,1-diamine |
| SMILES | C=C(N/C=C\N=C\C)N/C=C\C(C)C/C=C/C |
| InChI | InChI=1S/C14H23N3/c1-5-7-8-13(3)9-10-16-14(4)17-12-11-15-6-2/h5-7,9-13,16-17H,4,8H2,1-3H3/b7-5+,10-9-,12-11-,15-6+ |
| InChIKey | KGOIIIHFXBNHMM-RZZWUBGUSA-N |
| XLogP | 3.31 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|