C6H10FN — CID 174318587
(2R,4R)-2-ethenyl-4-fluoropyrrolidine (PubChem CID 174318587) has the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. Its IUPAC name is (2R,4R)-2-ethenyl-4-fluoropyrrolidine.
| Compound Name | (2R,4R)-2-ethenyl-4-fluoropyrrolidine |
|---|---|
| PubChem CID | 174318587 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | (2R,4R)-2-ethenyl-4-fluoropyrrolidine |
| SMILES | C=C[C@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C6H10FN/c1-2-6-3-5(7)4-8-6/h2,5-6,8H,1,3-4H2/t5-,6+/m1/s1 |
| InChIKey | UYPFJGUVOPWNPJ-RITPCOANSA-N |
| XLogP | 0.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|