About 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene
6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene (PubChem CID 174318861) has the molecular formula C17H33FO
and a molecular weight of 272.45 g/mol. Its IUPAC name is 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene.
Molecular Properties
| Compound Name | 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene |
| PubChem CID | 174318861 |
| Molecular Formula | C17H33FO |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene |
| SMILES | C=C(OC(C)(C)C)C(C)C(C)CC(C)(F)CCCC |
| InChI | InChI=1S/C17H33FO/c1-9-10-11-17(8,18)12-13(2)14(3)15(4)19-16(5,6)7/h13-14H,4,9-12H2,1-3,5-8H3 |
| InChIKey | NNTPCLUEPMYRPO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene?
The IUPAC name of 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene (CID 174318861) is 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene.
What is the SMILES notation for 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene?
The canonical SMILES for 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene is C=C(OC(C)(C)C)C(C)C(C)CC(C)(F)CCCC.
What is the InChIKey of 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene?
The InChIKey is NNTPCLUEPMYRPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33FO/c1-9-10-11-17(8,18)12-13(2)14(3)15(4)19-16(5,6)7/h13-14H,4,9-12H2,1-3,5-8H3.
What are the key properties of 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene?
6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene has a molecular weight of 272.45 g/mol, XLogP of 5.90, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,4,6-trimethyl-2-[(2-methylpropan-2-yl)oxy]dec-1-ene is sourced from PubChem (CID 174318861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).