C20H29NO2 — CID 174319014
N-[1-[5-ethenyl-6-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyran-2-yl]ethyl]propanamide (PubChem CID 174319014) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[1-[5-ethenyl-6-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyran-2-yl]ethyl]propanamide.
| Compound Name | N-[1-[5-ethenyl-6-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyran-2-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 174319014 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-[1-[5-ethenyl-6-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyran-2-yl]ethyl]propanamide |
| SMILES | C=CC1=C(C(=C)/C=C\C=C/CC)OC(C(C)NC(=O)CC)CC1 |
| InChI | InChI=1S/C20H29NO2/c1-6-9-10-11-12-15(4)20-17(7-2)13-14-18(23-20)16(5)21-19(22)8-3/h7,9-12,16,18H,2,4,6,8,13-14H2,1,3,5H3,(H,21,22)/b10-9-,12-11- |
| InChIKey | WUXXAUBBQIYDEL-BASFJDSNSA-N |
| XLogP | 4.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|