C17H30N2 — CID 174319616
5-methyl-N,1-di(propan-2-yl)-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-2-imine (PubChem CID 174319616) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 5-methyl-N,1-di(propan-2-yl)-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-2-imine.
| Compound Name | 5-methyl-N,1-di(propan-2-yl)-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-2-imine |
|---|---|
| PubChem CID | 174319616 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 5-methyl-N,1-di(propan-2-yl)-4,5,6,7,8,9-hexahydro-3H-cycloocta[b]pyrrol-2-imine |
| SMILES | CC1CCCCC2=C(C/C(=N\C(C)C)N2C(C)C)C1 |
| InChI | InChI=1S/C17H30N2/c1-12(2)18-17-11-15-10-14(5)8-6-7-9-16(15)19(17)13(3)4/h12-14H,6-11H2,1-5H3/b18-17+ |
| InChIKey | BXQAVXXQFXCAFW-ISLYRVAYSA-N |
| XLogP | 4.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|