About 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one
7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one (PubChem CID 174319655) has the molecular formula C19H36O3
and a molecular weight of 312.49 g/mol. Its IUPAC name is 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one.
Molecular Properties
| Compound Name | 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one |
| PubChem CID | 174319655 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCC(C)(C)OCCC(C)(C)OCCCC |
| InChI | InChI=1S/C19H36O3/c1-8-9-14-21-19(6,7)13-15-22-18(4,5)12-10-11-17(20)16(2)3/h2,8-15H2,1,3-7H3 |
| InChIKey | XVDBMGMVRCAJLG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one?
The IUPAC name of 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one (CID 174319655) is 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one.
What is the SMILES notation for 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one?
The canonical SMILES for 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one is C=C(C)C(=O)CCCC(C)(C)OCCC(C)(C)OCCCC.
What is the InChIKey of 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one?
The InChIKey is XVDBMGMVRCAJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O3/c1-8-9-14-21-19(6,7)13-15-22-18(4,5)12-10-11-17(20)16(2)3/h2,8-15H2,1,3-7H3.
What are the key properties of 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one?
7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one has a molecular weight of 312.49 g/mol, XLogP of 5.08, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-butoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one is sourced from PubChem (CID 174319655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).