C22H41NO — CID 174319710
(2S)-2-[[(3Z,6R,7Z,9S)-9-ethyl-6,8,10-trimethylundeca-3,7-dien-2-yl]amino]hex-5-en-2-ol (PubChem CID 174319710) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is (2S)-2-[[(3Z,6R,7Z,9S)-9-ethyl-6,8,10-trimethylundeca-3,7-dien-2-yl]amino]hex-5-en-2-ol.
| Compound Name | (2S)-2-[[(3Z,6R,7Z,9S)-9-ethyl-6,8,10-trimethylundeca-3,7-dien-2-yl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 174319710 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | (2S)-2-[[(3Z,6R,7Z,9S)-9-ethyl-6,8,10-trimethylundeca-3,7-dien-2-yl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@](C)(O)NC(C)/C=C\C[C@@H](C)/C=C(/C)[C@@H](CC)C(C)C |
| InChI | InChI=1S/C22H41NO/c1-9-11-15-22(8,24)23-20(7)14-12-13-18(5)16-19(6)21(10-2)17(3)4/h9,12,14,16-18,20-21,23-24H,1,10-11,13,15H2,2-8H3/b14-12-,19-16-/t18-,20?,21+,22+/m1/s1 |
| InChIKey | NPMMNKAYKZBAKY-ONGSMOTQSA-N |
| XLogP | 5.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|