About 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate
4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate (PubChem CID 174319910) has the molecular formula C14H26NO2S-
and a molecular weight of 272.43 g/mol. Its IUPAC name is 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate.
Molecular Properties
| Compound Name | 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate |
| PubChem CID | 174319910 |
| Molecular Formula | C14H26NO2S- |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate |
| SMILES | CC1=CCC(NCCC(C)S(=O)[O-])CC(C)(C)C1 |
| InChI | InChI=1S/C14H27NO2S/c1-11-5-6-13(10-14(3,4)9-11)15-8-7-12(2)18(16)17/h5,12-13,15H,6-10H2,1-4H3,(H,16,17)/p-1 |
| InChIKey | KJFDMWMHDBLPKM-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate?
The IUPAC name of 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate (CID 174319910) is 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate.
What is the SMILES notation for 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate?
The canonical SMILES for 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate is CC1=CCC(NCCC(C)S(=O)[O-])CC(C)(C)C1.
What is the InChIKey of 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate?
The InChIKey is KJFDMWMHDBLPKM-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H27NO2S/c1-11-5-6-13(10-14(3,4)9-11)15-8-7-12(2)18(16)17/h5,12-13,15H,6-10H2,1-4H3,(H,16,17)/p-1.
What are the key properties of 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate?
4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate has a molecular weight of 272.43 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,6,6-trimethylcyclohept-3-en-1-yl)amino]butane-2-sulfinate is sourced from PubChem (CID 174319910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).