C38H50F6N2O4 — CID 174320328
tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(5,5-difluoroheptan-2-yl)-3-fluorobenzoate (PubChem CID 174320328) has the molecular formula C38H50F6N2O4 and a molecular weight of 712.82 g/mol. Its IUPAC name is tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(5,5-difluoroheptan-2-yl)-3-fluorobenzoate.
| Compound Name | tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(5,5-difluoroheptan-2-yl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 174320328 |
| Molecular Formula | C38H50F6N2O4 |
| Molecular Weight | 712.82 g/mol |
| Exact Mass | 712.37 |
| IUPAC Name | tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(5,5-difluoroheptan-2-yl)-3-fluorobenzoate |
| SMILES | CCC(F)(F)CCC(C)c1ccc(F)c(COC[C@@H]2CN(Cc3ccccc3)CC23CN(C(=O)C(C)(C)C(F)(F)F)C3)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H50F6N2O4/c1-8-37(40,41)17-16-25(2)28-14-15-30(39)29(31(28)32(47)50-34(3,4)5)21-49-20-27-19-45(18-26-12-10-9-11-13-26)22-36(27)23-46(24-36)33(48)35(6,7)38(42,43)44/h9-15,25,27H,8,16-24H2,1-7H3/t25?,27-/m0/s1 |
| InChIKey | FTBVFXRAIKKACI-GPNIZQGCSA-N |
| XLogP | 8.78 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.82 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |