About 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine
5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine (PubChem CID 174320374) has the molecular formula C11H19F2N
and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine |
| PubChem CID | 174320374 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine |
| SMILES | C/N=C(/CC(=C(C)C)C(F)F)C(C)C |
| InChI | InChI=1S/C11H19F2N/c1-7(2)9(11(12)13)6-10(14-5)8(3)4/h8,11H,6H2,1-5H3/b14-10- |
| InChIKey | HVXHLXFORAVEJO-UVTDQMKNSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine?
The IUPAC name of 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine (CID 174320374) is 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine.
What is the SMILES notation for 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine?
The canonical SMILES for 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine is C/N=C(/CC(=C(C)C)C(F)F)C(C)C.
What is the InChIKey of 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine?
The InChIKey is HVXHLXFORAVEJO-UVTDQMKNSA-N. The full InChI is InChI=1S/C11H19F2N/c1-7(2)9(11(12)13)6-10(14-5)8(3)4/h8,11H,6H2,1-5H3/b14-10-.
What are the key properties of 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine?
5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine has a molecular weight of 203.28 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-N,2,6-trimethylhept-5-en-3-imine is sourced from PubChem (CID 174320374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).