About dichlorozirconium;2,7-dimethyl-9H-fluorene
dichlorozirconium;2,7-dimethyl-9H-fluorene (PubChem CID 174320466) has the molecular formula C15H14Cl2Zr
and a molecular weight of 356.41 g/mol. Its IUPAC name is dichlorozirconium;2,7-dimethyl-9H-fluorene.
Molecular Properties
| Compound Name | dichlorozirconium;2,7-dimethyl-9H-fluorene |
| PubChem CID | 174320466 |
| Molecular Formula | C15H14Cl2Zr |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | dichlorozirconium;2,7-dimethyl-9H-fluorene |
| SMILES | Cc1ccc2c(c1)Cc1cc(C)ccc1-2.Cl[Zr]Cl |
| InChI | InChI=1S/C15H14.2ClH.Zr/c1-10-3-5-14-12(7-10)9-13-8-11(2)4-6-15(13)14;;;/h3-8H,9H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | QOCOTJRBYMOIHK-UHFFFAOYSA-L |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorozirconium;2,7-dimethyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;2,7-dimethyl-9H-fluorene?
The IUPAC name of dichlorozirconium;2,7-dimethyl-9H-fluorene (CID 174320466) is dichlorozirconium;2,7-dimethyl-9H-fluorene.
What is the SMILES notation for dichlorozirconium;2,7-dimethyl-9H-fluorene?
The canonical SMILES for dichlorozirconium;2,7-dimethyl-9H-fluorene is Cc1ccc2c(c1)Cc1cc(C)ccc1-2.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;2,7-dimethyl-9H-fluorene?
The InChIKey is QOCOTJRBYMOIHK-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H14.2ClH.Zr/c1-10-3-5-14-12(7-10)9-13-8-11(2)4-6-15(13)14;;;/h3-8H,9H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;2,7-dimethyl-9H-fluorene?
dichlorozirconium;2,7-dimethyl-9H-fluorene has a molecular weight of 356.41 g/mol, XLogP of 5.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;2,7-dimethyl-9H-fluorene is sourced from PubChem (CID 174320466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).