About 2-methylpropan-1-ol;titanium;dihydrochloride
2-methylpropan-1-ol;titanium;dihydrochloride (PubChem CID 174321240) has the molecular formula C4H12Cl2OTi
and a molecular weight of 194.91 g/mol. Its IUPAC name is 2-methylpropan-1-ol;titanium;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylpropan-1-ol;titanium;dihydrochloride |
| PubChem CID | 174321240 |
| Molecular Formula | C4H12Cl2OTi |
| Molecular Weight | 194.91 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 2-methylpropan-1-ol;titanium;dihydrochloride |
| SMILES | CC(C)CO.Cl.Cl.[Ti] |
| InChI | InChI=1S/C4H10O.2ClH.Ti/c1-4(2)3-5;;;/h4-5H,3H2,1-2H3;2*1H; |
| InChIKey | LQKOEALCLMTGJW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.91 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropan-1-ol;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-ol;titanium;dihydrochloride?
The IUPAC name of 2-methylpropan-1-ol;titanium;dihydrochloride (CID 174321240) is 2-methylpropan-1-ol;titanium;dihydrochloride.
What is the SMILES notation for 2-methylpropan-1-ol;titanium;dihydrochloride?
The canonical SMILES for 2-methylpropan-1-ol;titanium;dihydrochloride is CC(C)CO.Cl.Cl.[Ti].
What is the InChIKey of 2-methylpropan-1-ol;titanium;dihydrochloride?
The InChIKey is LQKOEALCLMTGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.2ClH.Ti/c1-4(2)3-5;;;/h4-5H,3H2,1-2H3;2*1H;.
What are the key properties of 2-methylpropan-1-ol;titanium;dihydrochloride?
2-methylpropan-1-ol;titanium;dihydrochloride has a molecular weight of 194.91 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-ol;titanium;dihydrochloride is sourced from PubChem (CID 174321240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).