About 1H-indene;1-methylideneindene
1H-indene;1-methylideneindene (PubChem CID 174321289) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1H-indene;1-methylideneindene.
Molecular Properties
| Compound Name | 1H-indene;1-methylideneindene |
| PubChem CID | 174321289 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1H-indene;1-methylideneindene |
| SMILES | C1=Cc2ccccc2C1.C=C1C=Cc2ccccc21 |
| InChI | InChI=1S/C10H8.C9H8/c1-8-6-7-9-4-2-3-5-10(8)9;1-2-5-9-7-3-6-8(9)4-1/h2-7H,1H2;1-6H,7H2 |
| InChIKey | HAHMGQCDZDJIQT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indene;1-methylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;1-methylideneindene?
The IUPAC name of 1H-indene;1-methylideneindene (CID 174321289) is 1H-indene;1-methylideneindene.
What is the SMILES notation for 1H-indene;1-methylideneindene?
The canonical SMILES for 1H-indene;1-methylideneindene is C1=Cc2ccccc2C1.C=C1C=Cc2ccccc21.
What is the InChIKey of 1H-indene;1-methylideneindene?
The InChIKey is HAHMGQCDZDJIQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C9H8/c1-8-6-7-9-4-2-3-5-10(8)9;1-2-5-9-7-3-6-8(9)4-1/h2-7H,1H2;1-6H,7H2.
What are the key properties of 1H-indene;1-methylideneindene?
1H-indene;1-methylideneindene has a molecular weight of 244.34 g/mol, XLogP of 4.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;1-methylideneindene is sourced from PubChem (CID 174321289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).