About azane;5-hydroxy-2-methylhex-1-en-3-one
azane;5-hydroxy-2-methylhex-1-en-3-one (PubChem CID 174321351) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is azane;5-hydroxy-2-methylhex-1-en-3-one.
Molecular Properties
| Compound Name | azane;5-hydroxy-2-methylhex-1-en-3-one |
| PubChem CID | 174321351 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | azane;5-hydroxy-2-methylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(C)O.N |
| InChI | InChI=1S/C7H12O2.H3N/c1-5(2)7(9)4-6(3)8;/h6,8H,1,4H2,2-3H3;1H3 |
| InChIKey | UWXCEVLIOXFLND-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;5-hydroxy-2-methylhex-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-hydroxy-2-methylhex-1-en-3-one?
The IUPAC name of azane;5-hydroxy-2-methylhex-1-en-3-one (CID 174321351) is azane;5-hydroxy-2-methylhex-1-en-3-one.
What is the SMILES notation for azane;5-hydroxy-2-methylhex-1-en-3-one?
The canonical SMILES for azane;5-hydroxy-2-methylhex-1-en-3-one is C=C(C)C(=O)CC(C)O.N.
What is the InChIKey of azane;5-hydroxy-2-methylhex-1-en-3-one?
The InChIKey is UWXCEVLIOXFLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.H3N/c1-5(2)7(9)4-6(3)8;/h6,8H,1,4H2,2-3H3;1H3.
What are the key properties of azane;5-hydroxy-2-methylhex-1-en-3-one?
azane;5-hydroxy-2-methylhex-1-en-3-one has a molecular weight of 145.20 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-hydroxy-2-methylhex-1-en-3-one is sourced from PubChem (CID 174321351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).