About acetaldehyde;butan-2-ol;2-methylpropane
acetaldehyde;butan-2-ol;2-methylpropane (PubChem CID 174321366) has the molecular formula C10H24O2
and a molecular weight of 176.30 g/mol. Its IUPAC name is acetaldehyde;butan-2-ol;2-methylpropane.
Molecular Properties
| Compound Name | acetaldehyde;butan-2-ol;2-methylpropane |
| PubChem CID | 174321366 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | acetaldehyde;butan-2-ol;2-methylpropane |
| SMILES | CC(C)C.CC=O.CCC(C)O |
| InChI | InChI=1S/C4H10O.C4H10.C2H4O/c1-3-4(2)5;1-4(2)3;1-2-3/h4-5H,3H2,1-2H3;4H,1-3H3;2H,1H3 |
| InChIKey | UFNMXJGLJSNFPW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;butan-2-ol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;butan-2-ol;2-methylpropane?
The IUPAC name of acetaldehyde;butan-2-ol;2-methylpropane (CID 174321366) is acetaldehyde;butan-2-ol;2-methylpropane.
What is the SMILES notation for acetaldehyde;butan-2-ol;2-methylpropane?
The canonical SMILES for acetaldehyde;butan-2-ol;2-methylpropane is CC(C)C.CC=O.CCC(C)O.
What is the InChIKey of acetaldehyde;butan-2-ol;2-methylpropane?
The InChIKey is UFNMXJGLJSNFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.C4H10.C2H4O/c1-3-4(2)5;1-4(2)3;1-2-3/h4-5H,3H2,1-2H3;4H,1-3H3;2H,1H3.
What are the key properties of acetaldehyde;butan-2-ol;2-methylpropane?
acetaldehyde;butan-2-ol;2-methylpropane has a molecular weight of 176.30 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;butan-2-ol;2-methylpropane is sourced from PubChem (CID 174321366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).