About 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine
6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine (PubChem CID 174321389) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine.
Molecular Properties
| Compound Name | 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine |
| PubChem CID | 174321389 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine |
| SMILES | C=CC1=C(/C=C\CC)CN(C)CCS1 |
| InChI | InChI=1S/C12H19NS/c1-4-6-7-11-10-13(3)8-9-14-12(11)5-2/h5-7H,2,4,8-10H2,1,3H3/b7-6- |
| InChIKey | HWJAEKDNXLWCLJ-SREVYHEPSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine?
The IUPAC name of 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine (CID 174321389) is 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine.
What is the SMILES notation for 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine?
The canonical SMILES for 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine is C=CC1=C(/C=C\CC)CN(C)CCS1.
What is the InChIKey of 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine?
The InChIKey is HWJAEKDNXLWCLJ-SREVYHEPSA-N. The full InChI is InChI=1S/C12H19NS/c1-4-6-7-11-10-13(3)8-9-14-12(11)5-2/h5-7H,2,4,8-10H2,1,3H3/b7-6-.
What are the key properties of 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine?
6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine has a molecular weight of 209.36 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-but-1-enyl]-7-ethenyl-4-methyl-3,5-dihydro-2H-1,4-thiazepine is sourced from PubChem (CID 174321389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).