About 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane
1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane (PubChem CID 174322408) has the molecular formula C13H21BrO
and a molecular weight of 273.21 g/mol. Its IUPAC name is 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane.
Molecular Properties
| Compound Name | 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane |
| PubChem CID | 174322408 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane |
| SMILES | COC.Cc1cc(Br)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C11H15Br.C2H6O/c1-8-5-9(11(2,3)4)7-10(12)6-8;1-3-2/h5-7H,1-4H3;1-2H3 |
| InChIKey | VZXYQMAZWQAECU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane?
The IUPAC name of 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane (CID 174322408) is 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane.
What is the SMILES notation for 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane?
The canonical SMILES for 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane is COC.Cc1cc(Br)cc(C(C)(C)C)c1.
What is the InChIKey of 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane?
The InChIKey is VZXYQMAZWQAECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br.C2H6O/c1-8-5-9(11(2,3)4)7-10(12)6-8;1-3-2/h5-7H,1-4H3;1-2H3.
What are the key properties of 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane?
1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane has a molecular weight of 273.21 g/mol, XLogP of 4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-tert-butyl-5-methylbenzene;methoxymethane is sourced from PubChem (CID 174322408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).