C18H26F2N4S — CID 174322758
N-[(1Z)-buta-1,3-dienyl]-N'-[[5-[5-(difluoromethyl)hexa-2,5-dien-3-yl]-1H-imidazol-2-yl]methyl]-N'-ethylsulfanylmethanediamine (PubChem CID 174322758) has the molecular formula C18H26F2N4S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-N'-[[5-[5-(difluoromethyl)hexa-2,5-dien-3-yl]-1H-imidazol-2-yl]methyl]-N'-ethylsulfanylmethanediamine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-N'-[[5-[5-(difluoromethyl)hexa-2,5-dien-3-yl]-1H-imidazol-2-yl]methyl]-N'-ethylsulfanylmethanediamine |
|---|---|
| PubChem CID | 174322758 |
| Molecular Formula | C18H26F2N4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-N'-[[5-[5-(difluoromethyl)hexa-2,5-dien-3-yl]-1H-imidazol-2-yl]methyl]-N'-ethylsulfanylmethanediamine |
| SMILES | C=C/C=C\NCN(Cc1ncc(C(=CC)CC(=C)C(F)F)[nH]1)SCC |
| InChI | InChI=1S/C18H26F2N4S/c1-5-8-9-21-13-24(25-7-3)12-17-22-11-16(23-17)15(6-2)10-14(4)18(19)20/h5-6,8-9,11,18,21H,1,4,7,10,12-13H2,2-3H3,(H,22,23)/b9-8-,15-6? |
| InChIKey | BGSASHKJNZKNKG-GPKHQEQRSA-N |
| XLogP | 4.74 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|